C19H19ClN2O2S2 — CID 108784185
N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butane-1-sulfonamide (PubChem CID 108784185) has the molecular formula C19H19ClN2O2S2 and a molecular weight of 406.96 g/mol. Its IUPAC name is N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butane-1-sulfonamide.
| Compound Name | N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 108784185 |
| Molecular Formula | C19H19ClN2O2S2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1cccc(-c2csc(-c3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C19H19ClN2O2S2/c1-2-3-11-26(23,24)22-15-8-6-7-14(12-15)18-13-25-19(21-18)16-9-4-5-10-17(16)20/h4-10,12-13,22H,2-3,11H2,1H3 |
| InChIKey | OPZQMMAYXNMQPQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |