C22H14Cl2N2OS — CID 108770274
2-chloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 108770274) has the molecular formula C22H14Cl2N2OS and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-chloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 108770274 |
| Molecular Formula | C22H14Cl2N2OS |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2-chloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3ccccc3Cl)n2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C22H14Cl2N2OS/c23-18-10-3-1-8-16(18)21(27)25-15-7-5-6-14(12-15)20-13-28-22(26-20)17-9-2-4-11-19(17)24/h1-13H,(H,25,27) |
| InChIKey | BQJGFCFRZQYWIS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |