C23H14ClN3OS — CID 108748379
N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-cyanobenzamide (PubChem CID 108748379) has the molecular formula C23H14ClN3OS and a molecular weight of 415.91 g/mol. Its IUPAC name is N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-cyanobenzamide.
| Compound Name | N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 108748379 |
| Molecular Formula | C23H14ClN3OS |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2cccc(-c3csc(-c4ccccc4Cl)n3)c2)c1 |
| InChI | InChI=1S/C23H14ClN3OS/c24-20-10-2-1-9-19(20)23-27-21(14-29-23)16-6-4-8-18(12-16)26-22(28)17-7-3-5-15(11-17)13-25/h1-12,14H,(H,26,28) |
| InChIKey | MQTROHOUYJWILW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |