C22H13Cl3N2OS — CID 108748313
2,4-dichloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 108748313) has the molecular formula C22H13Cl3N2OS and a molecular weight of 459.79 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 108748313 |
| Molecular Formula | C22H13Cl3N2OS |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 2,4-dichloro-N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3ccccc3Cl)n2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H13Cl3N2OS/c23-14-8-9-16(19(25)11-14)21(28)26-15-5-3-4-13(10-15)20-12-29-22(27-20)17-6-1-2-7-18(17)24/h1-12H,(H,26,28) |
| InChIKey | RNYIBVGGRHFBGG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |