C23H15ClN4O5S — CID 108748287
N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2-methyl-3,5-dinitrobenzamide (PubChem CID 108748287) has the molecular formula C23H15ClN4O5S and a molecular weight of 494.92 g/mol. Its IUPAC name is N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2-methyl-3,5-dinitrobenzamide.
| Compound Name | N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 108748287 |
| Molecular Formula | C23H15ClN4O5S |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | N-[3-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]phenyl]-2-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c(C(=O)Nc2cccc(-c3csc(-c4ccccc4Cl)n3)c2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15ClN4O5S/c1-13-18(10-16(27(30)31)11-21(13)28(32)33)22(29)25-15-6-4-5-14(9-15)20-12-34-23(26-20)17-7-2-3-8-19(17)24/h2-12H,1H3,(H,25,29) |
| InChIKey | JGGYLKOCOHXNLR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|