C17H13Cl2N3OS — CID 42764139
2,4-dichloro-N-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 42764139) has the molecular formula C17H13Cl2N3OS and a molecular weight of 378.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42764139 |
| Molecular Formula | C17H13Cl2N3OS |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2,4-dichloro-N-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | CNc1nc(-c2cccc(NC(=O)c3ccc(Cl)cc3Cl)c2)cs1 |
| InChI | InChI=1S/C17H13Cl2N3OS/c1-20-17-22-15(9-24-17)10-3-2-4-12(7-10)21-16(23)13-6-5-11(18)8-14(13)19/h2-9H,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZZSLBSOHOYZMPR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |