C17H11BrCl2N2O2S — CID 2066122
N-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]-2,4-dichlorobenzamide (PubChem CID 2066122) has the molecular formula C17H11BrCl2N2O2S and a molecular weight of 458.16 g/mol. Its IUPAC name is N-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2066122 |
| Molecular Formula | C17H11BrCl2N2O2S |
| Molecular Weight | 458.16 g/mol |
| Exact Mass | 455.91 |
| IUPAC Name | N-[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]-2,4-dichlorobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)c3ccc(Cl)cc3Cl)n2)cc1Br |
| InChI | InChI=1S/C17H11BrCl2N2O2S/c1-24-15-5-2-9(6-12(15)18)14-8-25-17(21-14)22-16(23)11-4-3-10(19)7-13(11)20/h2-8H,1H3,(H,21,22,23) |
| InChIKey | NTWQVCYZQOTAHG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.16 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |