C22H15BrClN3O3S2 — CID 4659212
N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 4659212) has the molecular formula C22H15BrClN3O3S2 and a molecular weight of 548.87 g/mol. Its IUPAC name is N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4659212 |
| Molecular Formula | C22H15BrClN3O3S2 |
| Molecular Weight | 548.87 g/mol |
| Exact Mass | 546.94 |
| IUPAC Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3ccc(-c4ccc(Cl)cc4)o3)n2)cc1Br |
| InChI | InChI=1S/C22H15BrClN3O3S2/c1-29-18-7-4-13(10-15(18)23)16-11-32-22(25-16)27-21(31)26-20(28)19-9-8-17(30-19)12-2-5-14(24)6-3-12/h2-11H,1H3,(H2,25,26,27,28,31) |
| InChIKey | XSESALJDMXNXKN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.87 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|