C20H18BrN3O3S2 — CID 5230366
N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-ethoxybenzamide (PubChem CID 5230366) has the molecular formula C20H18BrN3O3S2 and a molecular weight of 492.42 g/mol. Its IUPAC name is N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-ethoxybenzamide.
| Compound Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 5230366 |
| Molecular Formula | C20H18BrN3O3S2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2nc(-c3ccc(OC)c(Br)c3)cs2)c1 |
| InChI | InChI=1S/C20H18BrN3O3S2/c1-3-27-14-6-4-5-13(9-14)18(25)23-19(28)24-20-22-16(11-29-20)12-7-8-17(26-2)15(21)10-12/h4-11H,3H2,1-2H3,(H2,22,23,24,25,28) |
| InChIKey | LSYASMKBTCHVHB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|