C24H26BrN3O3S2 — CID 5230786
N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-hexoxybenzamide (PubChem CID 5230786) has the molecular formula C24H26BrN3O3S2 and a molecular weight of 548.53 g/mol. Its IUPAC name is N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 5230786 |
| Molecular Formula | C24H26BrN3O3S2 |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2nc(-c3ccc(OC)c(Br)c3)cs2)cc1 |
| InChI | InChI=1S/C24H26BrN3O3S2/c1-3-4-5-6-13-31-18-10-7-16(8-11-18)22(29)27-23(32)28-24-26-20(15-33-24)17-9-12-21(30-2)19(25)14-17/h7-12,14-15H,3-6,13H2,1-2H3,(H2,26,27,28,29,32) |
| InChIKey | ZWAZXTJCZOSADB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|