C19H16FN3O3S2 — CID 54860548
N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methoxybenzamide (PubChem CID 54860548) has the molecular formula C19H16FN3O3S2 and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 54860548 |
| Molecular Formula | C19H16FN3O3S2 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2nc(-c3ccc(OC)c(F)c3)cs2)cc1 |
| InChI | InChI=1S/C19H16FN3O3S2/c1-25-13-6-3-11(4-7-13)17(24)22-18(27)23-19-21-15(10-28-19)12-5-8-16(26-2)14(20)9-12/h3-10H,1-2H3,(H2,21,22,23,24,27) |
| InChIKey | GUQNORHWHHVYSK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|