C25H21N3O3S2 — CID 17113568
N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 17113568) has the molecular formula C25H21N3O3S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17113568 |
| Molecular Formula | C25H21N3O3S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3ccc(OCc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H21N3O3S2/c1-30-20-11-7-18(8-12-20)22-16-33-25(26-22)28-24(32)27-23(29)19-9-13-21(14-10-19)31-15-17-5-3-2-4-6-17/h2-14,16H,15H2,1H3,(H2,26,27,28,29,32) |
| InChIKey | NEACCTPTJHMYAB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|