C19H16N4O5S2 — CID 23849497
4-methoxy-N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-nitrobenzamide (PubChem CID 23849497) has the molecular formula C19H16N4O5S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-methoxy-N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-methoxy-N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 23849497 |
| Molecular Formula | C19H16N4O5S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 4-methoxy-N-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3ccc(OC)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C19H16N4O5S2/c1-27-13-6-3-11(4-7-13)14-10-30-19(20-14)22-18(29)21-17(24)12-5-8-16(28-2)15(9-12)23(25)26/h3-10H,1-2H3,(H2,20,21,22,24,29) |
| InChIKey | SVWMATGHCLRBPW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|