C22H16BrN3O2S2 — CID 4527893
N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 4527893) has the molecular formula C22H16BrN3O2S2 and a molecular weight of 498.43 g/mol. Its IUPAC name is N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 4527893 |
| Molecular Formula | C22H16BrN3O2S2 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | N-[[4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3ccc4ccccc4c3)n2)cc1Br |
| InChI | InChI=1S/C22H16BrN3O2S2/c1-28-19-9-8-15(11-17(19)23)18-12-30-22(24-18)26-21(29)25-20(27)16-7-6-13-4-2-3-5-14(13)10-16/h2-12H,1H3,(H2,24,25,26,27,29) |
| InChIKey | LYXDCOOANGNDHB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|