C16H13N3OS2 — CID 17100090
N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide (PubChem CID 17100090) has the molecular formula C16H13N3OS2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide.
| Compound Name | N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 17100090 |
| Molecular Formula | C16H13N3OS2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C16H13N3OS2/c1-10(20)17-15(21)19-16-18-14(9-22-16)13-7-6-11-4-2-3-5-12(11)8-13/h2-9H,1H3,(H2,17,18,19,20,21) |
| InChIKey | CJTKEURTKXDMMZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|