C34H22N4O2S2 — CID 5130675
1-N,4-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide (PubChem CID 5130675) has the molecular formula C34H22N4O2S2 and a molecular weight of 582.71 g/mol. Its IUPAC name is 1-N,4-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 5130675 |
| Molecular Formula | C34H22N4O2S2 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | 1-N,4-N-bis(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)c1ccc(C(=O)Nc2nc(-c3ccc4ccccc4c3)cs2)cc1 |
| InChI | InChI=1S/C34H22N4O2S2/c39-31(37-33-35-29(19-41-33)27-15-9-21-5-1-3-7-25(21)17-27)23-11-13-24(14-12-23)32(40)38-34-36-30(20-42-34)28-16-10-22-6-2-4-8-26(22)18-28/h1-20H,(H,35,37,39)(H,36,38,40) |
| InChIKey | PMBADPHQPAEPCO-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |