C21H13F3N2OS — CID 7917212
N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)benzamide (PubChem CID 7917212) has the molecular formula C21H13F3N2OS and a molecular weight of 398.41 g/mol. Its IUPAC name is N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 7917212 |
| Molecular Formula | C21H13F3N2OS |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13F3N2OS/c22-21(23,24)17-9-7-14(8-10-17)19(27)26-20-25-18(12-28-20)16-6-5-13-3-1-2-4-15(13)11-16/h1-12H,(H,25,26,27) |
| InChIKey | YYCILFGPPJBFOD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |