C22H18N2O3S — CID 7917274
2-(4-methoxyphenoxy)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 7917274) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7917274 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2nc(-c3ccc4ccccc4c3)cs2)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-26-18-8-10-19(11-9-18)27-13-21(25)24-22-23-20(14-28-22)17-7-6-15-4-2-3-5-16(15)12-17/h2-12,14H,13H2,1H3,(H,23,24,25) |
| InChIKey | XXSWWYUQZLFOFY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |