C22H18N2O3S — CID 39218983
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide (PubChem CID 39218983) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 39218983 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-yloxyacetamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)COc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C22H18N2O3S/c1-26-20-9-5-4-8-18(20)19-14-28-22(23-19)24-21(25)13-27-17-11-10-15-6-2-3-7-16(15)12-17/h2-12,14H,13H2,1H3,(H,23,24,25) |
| InChIKey | YLGSLUGBIZTRSO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |