C15H20ClN3O2S — CID 119713306
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119713306) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119713306 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1nc(-c2ccccc2OC)cs1.Cl |
| InChI | InChI=1S/C15H19N3O2S.ClH/c1-16-9-5-8-14(19)18-15-17-12(10-21-15)11-6-3-4-7-13(11)20-2;/h3-4,6-7,10,16H,5,8-9H2,1-2H3,(H,17,18,19);1H |
| InChIKey | GBLKRMRGXZDOIQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|