C23H26N2O3S — CID 19229212
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide (PubChem CID 19229212) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide |
|---|---|
| PubChem CID | 19229212 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)CCCOc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C23H26N2O3S/c1-16(2)17-10-12-18(13-11-17)28-14-6-9-22(26)25-23-24-20(15-29-23)19-7-4-5-8-21(19)27-3/h4-5,7-8,10-13,15-16H,6,9,14H2,1-3H3,(H,24,25,26) |
| InChIKey | GJAJBGLCTUGFOC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|