C13H12N2O2S — CID 155557257
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 155557257) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155557257 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc(-c2ccccc2OC)cs1 |
| InChI | InChI=1S/C13H12N2O2S/c1-3-12(16)15-13-14-10(8-18-13)9-6-4-5-7-11(9)17-2/h3-8H,1H2,2H3,(H,14,15,16) |
| InChIKey | LOGVRRPIAYXNRW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|