C17H13N3O4S2 — CID 3473110
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 3473110) has the molecular formula C17H13N3O4S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3473110 |
| Molecular Formula | C17H13N3O4S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)C=Cc2ccc([N+](=O)[O-])s2)n1 |
| InChI | InChI=1S/C17H13N3O4S2/c1-24-14-5-3-2-4-12(14)13-10-25-17(18-13)19-15(21)8-6-11-7-9-16(26-11)20(22)23/h2-10H,1H3,(H,18,19,21) |
| InChIKey | XFWOUUMJASXQSS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|