C20H14FN3O2S2 — CID 55777240
(E)-3-(1,3-benzothiazol-2-yl)-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 55777240) has the molecular formula C20H14FN3O2S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55777240 |
| Molecular Formula | C20H14FN3O2S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(F)cc1-c1csc(NC(=O)/C=C/c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C20H14FN3O2S2/c1-26-16-7-6-12(21)10-13(16)15-11-27-20(23-15)24-18(25)8-9-19-22-14-4-2-3-5-17(14)28-19/h2-11H,1H3,(H,23,24,25)/b9-8+ |
| InChIKey | FAKRPQZNJIIDLU-CMDGGOBGSA-N |
| XLogP | 5.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|