C20H14F4N2O2S — CID 56506988
(Z)-4,4,4-trifluoro-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylbut-2-enamide (PubChem CID 56506988) has the molecular formula C20H14F4N2O2S and a molecular weight of 422.40 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylbut-2-enamide.
| Compound Name | (Z)-4,4,4-trifluoro-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56506988 |
| Molecular Formula | C20H14F4N2O2S |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (Z)-4,4,4-trifluoro-N-[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylbut-2-enamide |
| SMILES | COc1ccc(F)cc1-c1csc(NC(=O)/C=C(/c2ccccc2)C(F)(F)F)n1 |
| InChI | InChI=1S/C20H14F4N2O2S/c1-28-17-8-7-13(21)9-14(17)16-11-29-19(25-16)26-18(27)10-15(20(22,23)24)12-5-3-2-4-6-12/h2-11H,1H3,(H,25,26,27)/b15-10- |
| InChIKey | YZLHJHICDKYUFR-GDNBJRDFSA-N |
| XLogP | 5.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|