C20H14N4O6S — CID 55677481
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 55677481) has the molecular formula C20H14N4O6S and a molecular weight of 438.42 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55677481 |
| Molecular Formula | C20H14N4O6S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)n1 |
| InChI | InChI=1S/C20H14N4O6S/c1-30-15-8-3-2-5-11(15)13-10-31-20(21-13)22-16(25)9-23-18(26)12-6-4-7-14(24(28)29)17(12)19(23)27/h2-8,10H,9H2,1H3,(H,21,22,25) |
| InChIKey | OKYCGTZLTZZDSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|