C15H12N4O5S — CID 7959076
N-(4-methyl-1,3-thiazol-2-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 7959076) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 7959076 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1csc(NC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)n1 |
| InChI | InChI=1S/C15H12N4O5S/c1-8-7-25-15(16-8)17-11(20)5-6-18-13(21)9-3-2-4-10(19(23)24)12(9)14(18)22/h2-4,7H,5-6H2,1H3,(H,16,17,20) |
| InChIKey | LRRYLFFINPMNRD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|