C23H20N4O6S — CID 108738222
N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 108738222) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 108738222 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1ccc(-c2nc(NC(=O)CCN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)sc2C)cc1C |
| InChI | InChI=1S/C23H20N4O6S/c1-12-11-14(7-8-17(12)33-3)20-13(2)34-23(25-20)24-18(28)9-10-26-21(29)15-5-4-6-16(27(31)32)19(15)22(26)30/h4-8,11H,9-10H2,1-3H3,(H,24,25,28) |
| InChIKey | VPYFDWWGLLAUBV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|