C22H18ClN3O3S — CID 19197386
N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 19197386) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 19197386 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1sc(NC(=O)CCCN2C(=O)c3ccccc3C2=O)nc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O3S/c1-13-19(14-6-4-7-15(23)12-14)25-22(30-13)24-18(27)10-5-11-26-20(28)16-8-2-3-9-17(16)21(26)29/h2-4,6-9,12H,5,10-11H2,1H3,(H,24,25,27) |
| InChIKey | OTCVPSRAKZGWNW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|