C24H22N4O2S2 — CID 3493678
N,N'-bis(5-methyl-4-phenyl-1,3-thiazol-2-yl)butanediamide (PubChem CID 3493678) has the molecular formula C24H22N4O2S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N,N'-bis(5-methyl-4-phenyl-1,3-thiazol-2-yl)butanediamide.
| Compound Name | N,N'-bis(5-methyl-4-phenyl-1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 3493678 |
| Molecular Formula | C24H22N4O2S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N,N'-bis(5-methyl-4-phenyl-1,3-thiazol-2-yl)butanediamide |
| SMILES | Cc1sc(NC(=O)CCC(=O)Nc2nc(-c3ccccc3)c(C)s2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H22N4O2S2/c1-15-21(17-9-5-3-6-10-17)27-23(31-15)25-19(29)13-14-20(30)26-24-28-22(16(2)32-24)18-11-7-4-8-12-18/h3-12H,13-14H2,1-2H3,(H,25,27,29)(H,26,28,30) |
| InChIKey | FBPIAFAHAHIVGK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |