C19H18N2OS — CID 4099246
N-(4,5-diphenyl-1,3-thiazol-2-yl)butanamide (PubChem CID 4099246) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 4099246 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H18N2OS/c1-2-9-16(22)20-19-21-17(14-10-5-3-6-11-14)18(23-19)15-12-7-4-8-13-15/h3-8,10-13H,2,9H2,1H3,(H,20,21,22) |
| InChIKey | SWRVGRFTEGHYCV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |