C23H18N2O3S2 — CID 18573228
2-(benzenesulfonyl)-N-(4,5-diphenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 18573228) has the molecular formula C23H18N2O3S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(4,5-diphenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-(4,5-diphenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18573228 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(4,5-diphenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C23H18N2O3S2/c26-20(16-30(27,28)19-14-8-3-9-15-19)24-23-25-21(17-10-4-1-5-11-17)22(29-23)18-12-6-2-7-13-18/h1-15H,16H2,(H,24,25,26) |
| InChIKey | CFDYRXSNQGNAIU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |