C17H14N2O2S — CID 1244319
methyl N-(4,5-diphenyl-1,3-thiazol-2-yl)carbamate (PubChem CID 1244319) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is methyl N-(4,5-diphenyl-1,3-thiazol-2-yl)carbamate.
| Compound Name | methyl N-(4,5-diphenyl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 1244319 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | methyl N-(4,5-diphenyl-1,3-thiazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H14N2O2S/c1-21-17(20)19-16-18-14(12-8-4-2-5-9-12)15(22-16)13-10-6-3-7-11-13/h2-11H,1H3,(H,18,19,20) |
| InChIKey | MOHGLUSZOCIQRA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |