C12H13N3O2S — CID 58911903
ethyl N-(5-amino-4-phenyl-1,3-thiazol-2-yl)carbamate (PubChem CID 58911903) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl N-(5-amino-4-phenyl-1,3-thiazol-2-yl)carbamate.
| Compound Name | ethyl N-(5-amino-4-phenyl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 58911903 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethyl N-(5-amino-4-phenyl-1,3-thiazol-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1nc(-c2ccccc2)c(N)s1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-17-12(16)15-11-14-9(10(13)18-11)8-6-4-3-5-7-8/h3-7H,2,13H2,1H3,(H,14,15,16) |
| InChIKey | QGVJKTRMRITUIH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |