C14H11N3OS2 — CID 82342247
N-(5-amino-4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 82342247) has the molecular formula C14H11N3OS2 and a molecular weight of 301.40 g/mol. Its IUPAC name is N-(5-amino-4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5-amino-4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 82342247 |
| Molecular Formula | C14H11N3OS2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(5-amino-4-phenyl-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | Nc1sc(NC(=O)c2cccs2)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H11N3OS2/c15-12-11(9-5-2-1-3-6-9)16-14(20-12)17-13(18)10-7-4-8-19-10/h1-8H,15H2,(H,16,17,18) |
| InChIKey | WVTTWWMFKBKIPT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |