C13H9N3OS2 — CID 972595
N-(3-phenyl-1,2,4-thiadiazol-5-yl)thiophene-2-carboxamide (PubChem CID 972595) has the molecular formula C13H9N3OS2 and a molecular weight of 287.37 g/mol. Its IUPAC name is N-(3-phenyl-1,2,4-thiadiazol-5-yl)thiophene-2-carboxamide.
| Compound Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 972595 |
| Molecular Formula | C13H9N3OS2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)c1cccs1 |
| InChI | InChI=1S/C13H9N3OS2/c17-12(10-7-4-8-18-10)15-13-14-11(16-19-13)9-5-2-1-3-6-9/h1-8H,(H,14,15,16,17) |
| InChIKey | CHDAFYOXKXUPTN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |