C18H13N5OS — CID 87010055
1-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)pyrazole-4-carboxamide (PubChem CID 87010055) has the molecular formula C18H13N5OS and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)pyrazole-4-carboxamide.
| Compound Name | 1-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87010055 |
| Molecular Formula | C18H13N5OS |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H13N5OS/c24-17(14-11-19-23(12-14)15-9-5-2-6-10-15)21-18-20-16(22-25-18)13-7-3-1-4-8-13/h1-12H,(H,20,21,22,24) |
| InChIKey | YVBQEQUJCLWHFF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |