C9H7N3OS2 — CID 135291997
(3-phenyl-1,2,4-thiadiazol-5-yl)carbamothioic S-acid (PubChem CID 135291997) has the molecular formula C9H7N3OS2 and a molecular weight of 237.31 g/mol. Its IUPAC name is (3-phenyl-1,2,4-thiadiazol-5-yl)carbamothioic S-acid.
| Compound Name | (3-phenyl-1,2,4-thiadiazol-5-yl)carbamothioic S-acid |
|---|---|
| PubChem CID | 135291997 |
| Molecular Formula | C9H7N3OS2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | (3-phenyl-1,2,4-thiadiazol-5-yl)carbamothioic S-acid |
| SMILES | O=C(S)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C9H7N3OS2/c13-9(14)11-8-10-7(12-15-8)6-4-2-1-3-5-6/h1-5H,(H2,10,11,12,13,14) |
| InChIKey | LWWUASMCWHSQNS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|