C15H17N3OS — CID 10637031
N-(3-phenyl-1,2,4-thiadiazol-5-yl)cyclohexanecarboxamide (PubChem CID 10637031) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is N-(3-phenyl-1,2,4-thiadiazol-5-yl)cyclohexanecarboxamide.
| Compound Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 10637031 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)C1CCCCC1 |
| InChI | InChI=1S/C15H17N3OS/c19-14(12-9-5-2-6-10-12)17-15-16-13(18-20-15)11-7-3-1-4-8-11/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,16,17,18,19) |
| InChIKey | BSOQQLHCSQDASV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |