C15H18N4OS — CID 99804569
1-[(1R,2S)-2-methylcyclopentyl]-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 99804569) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methylcyclopentyl]-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-[(1R,2S)-2-methylcyclopentyl]-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 99804569 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[(1R,2S)-2-methylcyclopentyl]-3-(3-phenyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | C[C@H]1CCC[C@H]1NC(=O)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C15H18N4OS/c1-10-6-5-9-12(10)16-14(20)18-15-17-13(19-21-15)11-7-3-2-4-8-11/h2-4,7-8,10,12H,5-6,9H2,1H3,(H2,16,17,18,19,20)/t10-,12+/m0/s1 |
| InChIKey | LFHLAOFUSPUSMD-CMPLNLGQSA-N |
| XLogP | 3.52 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |