C16H19N3O2S — CID 87025493
2-cyclohexyloxy-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 87025493) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide.
| Compound Name | 2-cyclohexyloxy-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 87025493 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-cyclohexyloxy-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | O=C(COC1CCCCC1)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C16H19N3O2S/c20-14(11-21-13-9-5-2-6-10-13)17-16-18-15(19-22-16)12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,17,18,19,20) |
| InChIKey | VSDOENJNCQQENZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |