C20H19N3O3S2 — CID 49327440
4-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 49327440) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 4-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 49327440 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-cyclopentylsulfonyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)c1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C20H19N3O3S2/c24-19(22-20-21-18(23-27-20)14-6-2-1-3-7-14)15-10-12-17(13-11-15)28(25,26)16-8-4-5-9-16/h1-3,6-7,10-13,16H,4-5,8-9H2,(H,21,22,23,24) |
| InChIKey | HMOUFDVMBXJDII-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |