C15H10N6OS — CID 47050295
N-(3-phenyl-1,2,4-thiadiazol-5-yl)-2H-benzotriazole-5-carboxamide (PubChem CID 47050295) has the molecular formula C15H10N6OS and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(3-phenyl-1,2,4-thiadiazol-5-yl)-2H-benzotriazole-5-carboxamide.
| Compound Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 47050295 |
| Molecular Formula | C15H10N6OS |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-(3-phenyl-1,2,4-thiadiazol-5-yl)-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C15H10N6OS/c22-14(10-6-7-11-12(8-10)19-21-18-11)17-15-16-13(20-23-15)9-4-2-1-3-5-9/h1-8H,(H,18,19,21)(H,16,17,20,22) |
| InChIKey | HYNMTSWZPSDZFS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |