C11H8N6O — CID 29368084
N-pyrimidin-2-yl-2H-benzotriazole-5-carboxamide (PubChem CID 29368084) has the molecular formula C11H8N6O and a molecular weight of 240.23 g/mol. Its IUPAC name is N-pyrimidin-2-yl-2H-benzotriazole-5-carboxamide.
| Compound Name | N-pyrimidin-2-yl-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 29368084 |
| Molecular Formula | C11H8N6O |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N-pyrimidin-2-yl-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(Nc1ncccn1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C11H8N6O/c18-10(14-11-12-4-1-5-13-11)7-2-3-8-9(6-7)16-17-15-8/h1-6H,(H,15,16,17)(H,12,13,14,18) |
| InChIKey | OXNWVUYSZSZAFW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |