About N-pyrimidin-2-ylbenzamide;silver
N-pyrimidin-2-ylbenzamide;silver (PubChem CID 175574792) has the molecular formula C11H9AgN3O
and a molecular weight of 307.08 g/mol. Its IUPAC name is N-pyrimidin-2-ylbenzamide;silver.
Molecular Properties
| Compound Name | N-pyrimidin-2-ylbenzamide;silver |
| PubChem CID | 175574792 |
| Molecular Formula | C11H9AgN3O |
| Molecular Weight | 307.08 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | N-pyrimidin-2-ylbenzamide;silver |
| SMILES | O=C(Nc1ncccn1)c1ccccc1.[Ag] |
| InChI | InChI=1S/C11H9N3O.Ag/c15-10(9-5-2-1-3-6-9)14-11-12-7-4-8-13-11;/h1-8H,(H,12,13,14,15); |
| InChIKey | RNRKOHBPBMPXGP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-pyrimidin-2-ylbenzamide;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrimidin-2-ylbenzamide;silver?
The IUPAC name of N-pyrimidin-2-ylbenzamide;silver (CID 175574792) is N-pyrimidin-2-ylbenzamide;silver.
What is the SMILES notation for N-pyrimidin-2-ylbenzamide;silver?
The canonical SMILES for N-pyrimidin-2-ylbenzamide;silver is O=C(Nc1ncccn1)c1ccccc1.[Ag].
What is the InChIKey of N-pyrimidin-2-ylbenzamide;silver?
The InChIKey is RNRKOHBPBMPXGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O.Ag/c15-10(9-5-2-1-3-6-9)14-11-12-7-4-8-13-11;/h1-8H,(H,12,13,14,15);.
What are the key properties of N-pyrimidin-2-ylbenzamide;silver?
N-pyrimidin-2-ylbenzamide;silver has a molecular weight of 307.08 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrimidin-2-ylbenzamide;silver is sourced from PubChem (CID 175574792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).