C19H15N3O — CID 4121626
2,3-diphenyl-N-pyrimidin-2-ylprop-2-enamide (PubChem CID 4121626) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 2,3-diphenyl-N-pyrimidin-2-ylprop-2-enamide.
| Compound Name | 2,3-diphenyl-N-pyrimidin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4121626 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2,3-diphenyl-N-pyrimidin-2-ylprop-2-enamide |
| SMILES | O=C(Nc1ncccn1)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O/c23-18(22-19-20-12-7-13-21-19)17(16-10-5-2-6-11-16)14-15-8-3-1-4-9-15/h1-14H,(H,20,21,22,23) |
| InChIKey | QUJPVMNMBHRCEU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|