C21H14Cl3NO — CID 4287283
2,3-diphenyl-N-(2,4,5-trichlorophenyl)prop-2-enamide (PubChem CID 4287283) has the molecular formula C21H14Cl3NO and a molecular weight of 402.71 g/mol. Its IUPAC name is 2,3-diphenyl-N-(2,4,5-trichlorophenyl)prop-2-enamide.
| Compound Name | 2,3-diphenyl-N-(2,4,5-trichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4287283 |
| Molecular Formula | C21H14Cl3NO |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 2,3-diphenyl-N-(2,4,5-trichlorophenyl)prop-2-enamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl3NO/c22-17-12-19(24)20(13-18(17)23)25-21(26)16(15-9-5-2-6-10-15)11-14-7-3-1-4-8-14/h1-13H,(H,25,26) |
| InChIKey | YWJKMEYCBFISQI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|