C23H21NO2 — CID 6522812
(E)-N-(2-ethoxyphenyl)-2,3-diphenylprop-2-enamide (PubChem CID 6522812) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (E)-N-(2-ethoxyphenyl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(2-ethoxyphenyl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 6522812 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (E)-N-(2-ethoxyphenyl)-2,3-diphenylprop-2-enamide |
| SMILES | CCOc1ccccc1NC(=O)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO2/c1-2-26-22-16-10-9-15-21(22)24-23(25)20(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-17H,2H2,1H3,(H,24,25)/b20-17+ |
| InChIKey | LRIVLYKUNNQWCL-LVZFUZTISA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|