C12H11Cl2NO4 — CID 852528
(E)-2,3-dichloro-4-(2-ethoxyanilino)-4-oxobut-2-enoic acid (PubChem CID 852528) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is (E)-2,3-dichloro-4-(2-ethoxyanilino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-2,3-dichloro-4-(2-ethoxyanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 852528 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (E)-2,3-dichloro-4-(2-ethoxyanilino)-4-oxobut-2-enoic acid |
| SMILES | CCOc1ccccc1NC(=O)/C(Cl)=C(\Cl)C(=O)O |
| InChI | InChI=1S/C12H11Cl2NO4/c1-2-19-8-6-4-3-5-7(8)15-11(16)9(13)10(14)12(17)18/h3-6H,2H2,1H3,(H,15,16)(H,17,18)/b10-9+ |
| InChIKey | FWYKXJCNEPARGF-MDZDMXLPSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|