C16H15IN2O3 — CID 108531107
N'-(2-ethoxyphenyl)-N-(4-iodophenyl)oxamide (PubChem CID 108531107) has the molecular formula C16H15IN2O3 and a molecular weight of 410.21 g/mol. Its IUPAC name is N'-(2-ethoxyphenyl)-N-(4-iodophenyl)oxamide.
| Compound Name | N'-(2-ethoxyphenyl)-N-(4-iodophenyl)oxamide |
|---|---|
| PubChem CID | 108531107 |
| Molecular Formula | C16H15IN2O3 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | N'-(2-ethoxyphenyl)-N-(4-iodophenyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H15IN2O3/c1-2-22-14-6-4-3-5-13(14)19-16(21)15(20)18-12-9-7-11(17)8-10-12/h3-10H,2H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | BXNIGZROXDFEFW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|